CAS 1354951-10-2

1-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-5-methyl-, hydrochloride (1:1)

Description:

1-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-5-methyl-, hydrochloride (1:1) is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. This substance features a carboxylic acid functional group, contributing to its acidic properties, and a tetrahydroisoquinoline moiety, indicating that it is a saturated derivative of isoquinoline. The presence of a methyl group at the 5-position enhances its hydrophobic characteristics. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can influence its bioavailability and reactivity in various chemical environments. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular interactions can be influenced by the presence of the hydrochloride, which can affect its pharmacokinetics and pharmacodynamics. Overall, this compound's unique structural features and properties make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₁H₁₃NO₂·ClH

InChI: InChI=1S/C11H13NO2.ClH/c1-7-3-2-4-9-8(7)5-6-12-10(9)11(13)14;/h2-4,10,12H,5-6H2,1H3,(H,13,14);1H

InChI key: InChIKey=IAJAHVAZBKGRDN-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C=2C(=C(C)C=CC2)CCN1.Cl

Synonyms:

• 1-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-5-methyl-, hydrochloride (1:1)

5-Methyl-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid hydrochloride

CAS: 1354951-10-2

Versatile small molecule scaffold

Formula: C₁₁H₁₄ClNO₂

Purity: Min. 95%

Molecular weight: 227.69 g/mol

Ref: 3D-EEC95110