
CAS 1354951-20-4
:Description:
The chemical substance with the CAS number 1354951-20-4 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds with unique CAS numbers can exhibit a range of properties, including molecular structure, solubility, boiling and melting points, and reactivity. The characteristics of a chemical substance are often determined by its molecular formula, functional groups, and overall structure, which influence its physical and chemical behavior. For precise information, including safety data, toxicity, and applications, it is advisable to consult specialized chemical databases, scientific literature, or material safety data sheets (MSDS) that provide comprehensive details about the specific compound in question. If you have access to a chemical database or scientific resources, you may find more targeted information regarding its characteristics and potential uses.
Formula:C15H23N3O·ClH
InChI:InChI=1S/C15H23N3O.ClH/c16-15(9-5-2-6-10-15)14-17-12-8-4-1-3-7-11(12)13(19)18-14;/h1-10,16H2,(H,17,18,19);1H
InChI key:InChIKey=DOTMLBHZXYFCEY-UHFFFAOYSA-N
SMILES:NC1(C=2NC3=C(C(=O)N2)CCCCC3)CCCCC1.Cl
Synonyms:- 2-(1-Aminocyclohexyl)-3H,4H,5H,6H,7H,8H,9H-cyclohepta[d]pyrimidin-4-one hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.