CymitQuimica logo

CAS 1354951-28-2

:

1,1-Dimethylethyl 4-(3-methoxyphenyl)-3-oxo-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 4-(3-methoxyphenyl)-3-oxo-1-piperidinecarboxylate, identified by its CAS number 1354951-28-2, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a carboxylate group, and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with both lipophilicity and moderate polarity due to the presence of the methoxy group and the ester functionality. It may display biological activity, potentially serving as a pharmacophore in medicinal chemistry, particularly in the development of therapeutic agents. The presence of the dimethyl group contributes to steric hindrance, which can influence its reactivity and interaction with biological targets. Additionally, the compound's stability and solubility can be affected by the functional groups present, making it of interest in various chemical and pharmaceutical applications. Overall, this compound exemplifies the intricate balance of structural features that can dictate its chemical behavior and potential utility in research and development.
Formula:C17H23NO4
InChI:InChI=1S/C17H23NO4/c1-17(2,3)22-16(20)18-9-8-14(15(19)11-18)12-6-5-7-13(10-12)21-4/h5-7,10,14H,8-9,11H2,1-4H3
InChI key:InChIKey=OAWXZZLRKNJQJS-UHFFFAOYSA-N
SMILES:O=C1C(CCN(C(OC(C)(C)C)=O)C1)C2=CC(OC)=CC=C2
Synonyms:
  • 1,1-Dimethylethyl 4-(3-methoxyphenyl)-3-oxo-1-piperidinecarboxylate
  • 1-Piperidinecarboxylic acid, 4-(3-methoxyphenyl)-3-oxo-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.