CAS 1354951-31-7

Benzenemethanol, α-(1-aminoethyl)-2,6-dichloro-, hydrochloride (1:1)

Description:

Benzenemethanol, α-(1-aminoethyl)-2,6-dichloro-, hydrochloride (1:1), identified by CAS number 1354951-31-7, is a chemical compound characterized by its structure, which includes a benzene ring substituted with a methanol group and an aminoethyl side chain, along with two chlorine atoms at the 2 and 6 positions of the benzene ring. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The presence of the amino group suggests potential interactions with biological systems, making it of interest in pharmaceutical research. The dichloro substitutions may also impart specific reactivity or stability characteristics. As with many chlorinated compounds, it is essential to consider environmental and health implications, including potential toxicity and bioaccumulation. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry and related fields.

Formula: C₉H₁₁Cl₂NO·ClH

InChI: InChI=1S/C9H11Cl2NO.ClH/c1-5(12)9(13)8-6(10)3-2-4-7(8)11;/h2-5,9,13H,12H2,1H3;1H

InChI key: InChIKey=CNUADCUEUPMLMX-UHFFFAOYSA-N

SMILES: C(C(C)N)(O)C1=C(Cl)C=CC=C1Cl.Cl

Synonyms:

• Benzenemethanol, α-(1-aminoethyl)-2,6-dichloro-, hydrochloride (1:1)

2-Amino-1-(2,6-dichlorophenyl)propan-1-ol hydrochloride

Controlled Product

CAS: 1354951-31-7

Versatile small molecule scaffold

Formula: C₉H₁₂Cl₃NO

Purity: Min. 95%

Molecular weight: 256.6 g/mol

Ref: 3D-EEC95131