CymitQuimica logo

CAS 1354951-34-0

:

Cyclopropanamine, 2-(2,3-difluorophenyl)-, hydrochloride (1:1)

Description:
Cyclopropanamine, 2-(2,3-difluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its cyclopropane structure, which contributes to its unique reactivity and steric properties. The presence of a difluorophenyl group enhances its potential for interactions with biological targets, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in pharmaceutical formulations. The compound's molecular structure suggests it may exhibit specific pharmacological activities, potentially influencing neurotransmitter systems or other biological pathways. Its CAS number, 1354951-34-0, allows for precise identification in chemical databases. Safety and handling considerations are essential, as with many amines and halogenated compounds, due to potential toxicity and reactivity. Overall, this compound represents a class of substances that may have applications in drug development, particularly in the search for new therapeutic agents.
Formula:C9H9F2N·ClH
InChI:InChI=1S/C9H9F2N.ClH/c10-7-3-1-2-5(9(7)11)6-4-8(6)12;/h1-3,6,8H,4,12H2;1H
InChI key:InChIKey=APPPWEDMBMWHEM-UHFFFAOYSA-N
SMILES:NC1C(C1)C2=C(F)C(F)=CC=C2.Cl
Synonyms:
  • Cyclopropanamine, 2-(2,3-difluorophenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.