CAS 1354951-42-0

Carbamothioic acid, N,N-dimethyl-, S-[4-(methoxymethyl)phenyl] ester

Description:

Carbamothioic acid, N,N-dimethyl-, S-[4-(methoxymethyl)phenyl] ester is an organic compound characterized by its functional groups, including a carbamothioic acid moiety and an ester linkage. This compound features a dimethylamino group, which contributes to its basicity and potential nucleophilicity. The presence of the methoxymethyl group on the phenyl ring enhances its lipophilicity, potentially influencing its solubility and reactivity in organic solvents. The structure suggests that it may exhibit biological activity, possibly as a result of its ability to interact with various biological targets. Additionally, the compound may participate in various chemical reactions typical of esters and thioesters, such as hydrolysis and transesterification. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₁₅NO₂S

InChI: InChI=1S/C11H15NO2S/c1-12(2)11(13)15-10-6-4-9(5-7-10)8-14-3/h4-7H,8H2,1-3H3

InChI key: InChIKey=KJTGAPXRPRTQFY-UHFFFAOYSA-N

SMILES: S(C(N(C)C)=O)C1=CC=C(COC)C=C1

Synonyms:

• 1-{[4-(Methoxymethyl)phenyl]sulfanyl}-N,N-dimethylformamide
• Carbamothioic acid, N,N-dimethyl-, S-[4-(methoxymethyl)phenyl] ester

1-{[4-(Methoxymethyl)phenyl]sulfanyl}-N,N-dimethylformamide

CAS: 1354951-42-0

Versatile small molecule scaffold

Formula: C₁₁H₁₅NO₂S

Purity: Min. 95%

Molecular weight: 225.31 g/mol

Ref: 3D-EEC95142