CAS 1354951-61-3

2-Thiazoleacetamide, 4-(chloromethyl)-N-methyl-, hydrochloride (1:1)

Description:

2-Thiazoleacetamide, 4-(chloromethyl)-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. This compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The presence of the N-methyl group indicates that a methyl group is attached to the nitrogen atom, influencing its solubility and biological activity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and research. The compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of other bioactive molecules. Its specific properties, such as melting point, solubility, and reactivity, would depend on the conditions under which it is handled and the presence of other substances. Safety data should be consulted for handling and storage, as with any chemical compound.

Formula: C₇H₉ClN₂OS·ClH

InChI: InChI=1S/C7H9ClN2OS.ClH/c1-9-6(11)2-7-10-5(3-8)4-12-7;/h4H,2-3H2,1H3,(H,9,11);1H

InChI key: InChIKey=RNDPDOPHPFSXOY-UHFFFAOYSA-N

SMILES: C(C(NC)=O)C1=NC(CCl)=CS1.Cl

Synonyms:

• 2-Thiazoleacetamide, 4-(chloromethyl)-N-methyl-, hydrochloride (1:1)

2-[4-(Chloromethyl)-1,3-thiazol-2-yl]-N-methylacetamide hydrochloride

CAS: 1354951-61-3

Versatile small molecule scaffold

Formula: C₇H₁₀Cl₂N₂OS

Purity: Min. 95%

Molecular weight: 241.14 g/mol

Ref: 3D-EEC95161