
CAS 1354951-64-6
:1,1-Dimethylethyl 4-(3,5-dimethylphenyl)-3-hydroxy-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 4-(3,5-dimethylphenyl)-3-hydroxy-1-piperidinecarboxylate, identified by its CAS number 1354951-64-6, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and is substituted with a carboxylate group and a hydroxy group, contributing to its potential biological activity. The presence of the 3,5-dimethylphenyl group indicates that it has aromatic characteristics, which can influence its reactivity and interactions with biological targets. The tert-butyl group (1,1-dimethylethyl) enhances the lipophilicity of the molecule, potentially affecting its solubility and permeability in biological systems. Such compounds are often investigated for their pharmacological properties, including their potential as therapeutic agents. The specific characteristics, such as melting point, boiling point, and solubility, would require empirical data for precise values, but the structural features suggest a complex interplay of hydrophobic and hydrophilic interactions.
Formula:C18H27NO3
InChI:InChI=1S/C18H27NO3/c1-12-8-13(2)10-14(9-12)15-6-7-19(11-16(15)20)17(21)22-18(3,4)5/h8-10,15-16,20H,6-7,11H2,1-5H3
InChI key:InChIKey=KHMGZNIRQIAIRT-UHFFFAOYSA-N
SMILES:OC1C(C2=CC(C)=CC(C)=C2)CCN(C(OC(C)(C)C)=O)C1
Synonyms:- 1-Piperidinecarboxylic acid, 4-(3,5-dimethylphenyl)-3-hydroxy-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 4-(3,5-dimethylphenyl)-3-hydroxy-1-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.