CAS 1354951-69-1

Piperidine, 3-[(5-chloro-2-methoxyphenyl)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[(5-chloro-2-methoxyphenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 5-chloro-2-methoxyphenyl group attached to the piperidine at the 3-position, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the chlorine and methoxy substituents on the phenyl ring may influence the compound's pharmacological profile, potentially affecting its interaction with biological targets. This compound is of interest in medicinal chemistry and may be investigated for its therapeutic potential, although specific biological activities and safety profiles would require further research and validation. Proper handling and storage conditions should be observed due to its chemical nature and potential effects.

Formula: C₁₃H₁₈ClNO·ClH

InChI: InChI=1S/C13H18ClNO.ClH/c1-16-13-5-4-12(14)8-11(13)7-10-3-2-6-15-9-10;/h4-5,8,10,15H,2-3,6-7,9H2,1H3;1H

InChI key: InChIKey=SEHMYRXQBWGMGR-UHFFFAOYSA-N

SMILES: C(C1=C(OC)C=CC(Cl)=C1)C2CCCNC2.Cl

Synonyms:

• Piperidine, 3-[(5-chloro-2-methoxyphenyl)methyl]-, hydrochloride (1:1)

3-[(5-Chloro-2-methoxyphenyl)methyl]piperidine hydrochloride

CAS: 1354951-69-1

Versatile small molecule scaffold

Formula: C₁₃H₁₉Cl₂NO

Purity: Min. 95%

Molecular weight: 276.2 g/mol

Ref: 3D-EEC95169