
CAS 1354951-85-1
:Cyclopropanemethanamine, 2-methyl-N-(1-methylethyl)-, hydrochloride (1:1)
Description:
Cyclopropanemethanamine, 2-methyl-N-(1-methylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique cyclopropane structure, which contributes to its reactivity and potential applications in organic synthesis. The presence of the amine functional group indicates that it can participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. The hydrochloride form suggests that the compound is a salt, which typically enhances its solubility in water and stability under certain conditions. This compound may exhibit biological activity due to its amine functionality, making it of interest in pharmaceutical research. Its molecular structure includes a branched alkyl group, which can influence its steric properties and interactions with other molecules. Overall, the characteristics of this compound make it a subject of interest in both synthetic chemistry and potential medicinal applications, although specific properties such as melting point, boiling point, and reactivity would require further empirical investigation.
Formula:C8H17N·ClH
InChI:InChI=1S/C8H17N.ClH/c1-6(2)9-5-8-4-7(8)3;/h6-9H,4-5H2,1-3H3;1H
InChI key:InChIKey=DXHGLWSYEJKHJQ-UHFFFAOYSA-N
SMILES:C(NC(C)C)C1C(C)C1.Cl
Synonyms:- Cyclopropanemethanamine, 2-methyl-N-(1-methylethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.