CymitQuimica logo

CAS 1354951-90-8

:

3-Fluoro-α-methyl-4-(methylsulfonyl)benzenemethanamine

Description:
3-Fluoro-α-methyl-4-(methylsulfonyl)benzenemethanamine, with the CAS number 1354951-90-8, is a chemical compound characterized by its unique structural features. It contains a fluorine atom, which contributes to its reactivity and potential biological activity. The presence of a methylsulfonyl group enhances its solubility and may influence its pharmacokinetic properties. This compound is likely to exhibit polar characteristics due to the sulfonyl group, which can engage in hydrogen bonding and dipole interactions. The α-methyl group provides steric hindrance, potentially affecting its interaction with biological targets. As a substituted aniline, it may exhibit properties relevant to medicinal chemistry, including potential use as a pharmaceutical agent. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability would depend on the specific conditions under which it is handled. Overall, this compound's unique functional groups suggest it may have interesting applications in drug development or as a research tool in chemical biology.
Formula:C9H12FNO2S
InChI:InChI=1S/C9H12FNO2S/c1-6(11)7-3-4-9(8(10)5-7)14(2,12)13/h3-6H,11H2,1-2H3
InChI key:InChIKey=YJKUDHLKUJJLEE-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(F)C=C(C(C)N)C=C1
Synonyms:
  • Benzenemethanamine, 3-fluoro-α-methyl-4-(methylsulfonyl)-
  • 3-Fluoro-α-methyl-4-(methylsulfonyl)benzenemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.