CAS 1354952-09-2

5-Cyclopropyl-N,4-dimethyl-4H-1,2,4-triazole-3-methanamine

Description:

5-Cyclopropyl-N,4-dimethyl-4H-1,2,4-triazole-3-methanamine is a chemical compound characterized by its unique triazole ring structure, which contributes to its potential biological activity. The presence of the cyclopropyl group enhances its lipophilicity and may influence its interaction with biological targets. The dimethyl substitution at the 4-position of the triazole ring can affect the compound's electronic properties and steric hindrance, potentially impacting its reactivity and binding affinity. As a methanamine derivative, it may exhibit basic properties due to the amine functional group, which can participate in hydrogen bonding and protonation reactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could lead to specific pharmacological effects. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be assessed under various conditions to determine its suitability for intended applications.

Formula: C₈H₁₄N₄

InChI: InChI=1S/C8H14N4/c1-9-5-7-10-11-8(12(7)2)6-3-4-6/h6,9H,3-5H2,1-2H3

InChI key: InChIKey=NNZAJHWGMAZTPB-UHFFFAOYSA-N

SMILES: CN1C(=NN=C1CNC)C2CC2

Synonyms:

• 5-Cyclopropyl-N,4-dimethyl-4H-1,2,4-triazole-3-methanamine
• 4H-1,2,4-Triazole-3-methanamine, 5-cyclopropyl-N,4-dimethyl-

[(5-Cyclopropyl-4-methyl-4H-1,2,4-triazol-3-yl)methyl](methyl)amine

CAS: 1354952-09-2

Versatile small molecule scaffold

Formula: C₈H₁₄N₄

Purity: Min. 95%

Molecular weight: 166.22 g/mol

Ref: 3D-EEC95209