CAS 1354952-13-8
:6,6-Difluorospiro[3.3]heptan-2-amine
Description:
6,6-Difluorospiro[3.3]heptan-2-amine is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework with a nitrogen-containing amine functional group. The presence of two fluorine atoms at the 6-position of the spiro system contributes to its distinctive reactivity and potential applications in medicinal chemistry and material science. The spiro configuration often imparts interesting stereochemical properties, which can influence the compound's biological activity and interaction with other molecules. This compound may exhibit properties such as increased lipophilicity due to the fluorine substituents, which can enhance membrane permeability. Additionally, the amine group can participate in hydrogen bonding, affecting solubility and reactivity. Overall, 6,6-Difluorospiro[3.3]heptan-2-amine represents a class of compounds that may be of interest for further research in drug development and synthetic chemistry, particularly due to its potential for modifying biological pathways or serving as a building block for more complex molecules.
Formula:C7H11F2N
InChI:InChI=1S/C7H11F2N/c8-7(9)3-6(4-7)1-5(10)2-6/h5H,1-4,10H2
InChI key:InChIKey=KNHIUDDGPFPSFP-UHFFFAOYSA-N
SMILES:FC1(F)CC2(C1)CC(N)C2
Synonyms:- 6,6-Difluorospiro[3.3]heptan-2-amine
- Spiro[3.3]heptan-2-amine, 6,6-difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.