CAS 1354952-24-1

Benzenemethanamine, 4,5-dimethoxy-N-methyl-2-(methylthio)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4,5-dimethoxy-N-methyl-2-(methylthio)-, hydrochloride (1:1), with CAS number 1354952-24-1, is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with methoxy groups and a methylthio group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in various applications. The presence of the methoxy groups suggests potential for interactions with biological systems, possibly influencing its pharmacological properties. The methylthio group may also contribute to its reactivity and biological activity. As a member of the amine class, it may exhibit basic properties, allowing it to participate in various chemical reactions, including alkylation and acylation. Its specific applications can vary, but compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. Safety data and handling precautions should be considered due to the potential biological activity and toxicity associated with similar compounds.

Formula: C₁₁H₁₇NO₂S·ClH

InChI: InChI=1S/C11H17NO2S.ClH/c1-12-7-8-5-9(13-2)10(14-3)6-11(8)15-4;/h5-6,12H,7H2,1-4H3;1H

InChI key: InChIKey=DUSWUWPKVUKCKS-UHFFFAOYSA-N

SMILES: C(NC)C1=C(SC)C=C(OC)C(OC)=C1.Cl

Synonyms:

• Benzenemethanamine, 4,5-dimethoxy-N-methyl-2-(methylthio)-, hydrochloride (1:1)

{[4,5-Dimethoxy-2-(methylsulfanyl)phenyl]methyl}(methyl)amine hydrochloride

CAS: 1354952-24-1

Versatile small molecule scaffold

Formula: C₁₁H₁₈ClNO₂S

Purity: Min. 95%

Molecular weight: 263.78 g/mol

Ref: 3D-EEC95224