CAS 1354952-30-9

2-Chloro-N-[4-(2,3-dihydro-1H-indol-1-yl)phenyl]acetamide

Description:

2-Chloro-N-[4-(2,3-dihydro-1H-indol-1-yl)phenyl]acetamide is a chemical compound characterized by its unique structure, which includes a chloro substituent and an indole moiety. This compound features a chloro group attached to an acetamide functional group, which contributes to its potential biological activity. The presence of the indole ring, a common structure in many biologically active compounds, suggests that it may interact with various biological targets, potentially exhibiting pharmacological properties. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, depending on its specific molecular interactions. Its molecular weight and specific functional groups may influence its reactivity and stability under different conditions. As with many compounds containing halogens and nitrogen, it may exhibit polar characteristics, affecting its behavior in biological systems. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential bioactivity. Further studies would be necessary to fully elucidate its properties and potential applications in medicinal chemistry.

Formula: C₁₆H₁₅ClN₂O

InChI: InChI=1S/C16H15ClN2O/c17-11-16(20)18-13-5-7-14(8-6-13)19-10-9-12-3-1-2-4-15(12)19/h1-8H,9-11H2,(H,18,20)

InChI key: InChIKey=DBCXVEIQFRNKSU-UHFFFAOYSA-N

SMILES: N(C(CCl)=O)C1=CC=C(N2C=3C(CC2)=CC=CC3)C=C1

Synonyms:

• 2-Chloro-N-[4-(2,3-dihydro-1H-indol-1-yl)phenyl]acetamide
• Acetamide, 2-chloro-N-[4-(2,3-dihydro-1H-indol-1-yl)phenyl]-

2-Chloro-N-[4-(2,3-dihydro-1H-indol-1-yl)phenyl]acetamide

CAS: 1354952-30-9

Versatile small molecule scaffold

Formula: C₁₆H₁₅ClN₂O

Purity: Min. 95%

Molecular weight: 286.75 g/mol

Ref: 3D-EEC95230