CymitQuimica logo

CAS 1354952-38-7

:

3-(2-Methylphenyl)isoxazolo[5,4-b]pyridine-5-carboxylic acid

Description:
3-(2-Methylphenyl)isoxazolo[5,4-b]pyridine-5-carboxylic acid is a chemical compound characterized by its unique structural features, which include an isoxazole ring fused to a pyridine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the carboxylic acid functional group suggests it may engage in hydrogen bonding, influencing its reactivity and interactions with other molecules. The 2-methylphenyl substituent can enhance lipophilicity, potentially affecting its pharmacokinetic properties. Additionally, compounds of this nature may be investigated for their roles in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound represents a class of organic molecules with potential applications in drug discovery and development.
Formula:C14H10N2O3
InChI:InChI=1S/C14H10N2O3/c1-8-4-2-3-5-10(8)12-11-6-9(14(17)18)7-15-13(11)19-16-12/h2-7H,1H3,(H,17,18)
InChI key:InChIKey=JIUDUNZWOYVAPJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C2C(=NOC2=NC1)C3=C(C)C=CC=C3
Synonyms:
  • Isoxazolo[5,4-b]pyridine-5-carboxylic acid, 3-(2-methylphenyl)-
  • 3-(2-Methylphenyl)isoxazolo[5,4-b]pyridine-5-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.