CAS 1354952-50-3: 3-[(2-Chlorophenyl)methyl]-1-[(4-methylphenyl)sulfonyl]azetidine

Description: 3-[(2-Chlorophenyl)methyl]-1-[(4-methylphenyl)sulfonyl]azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a 2-chlorophenyl group attached to a methyl group, contributing to its lipophilicity and potential biological activity. Additionally, it has a sulfonyl group linked to a 4-methylphenyl moiety, which may enhance its solubility and reactivity. The presence of these functional groups suggests that the compound could exhibit interesting pharmacological properties, potentially acting as a ligand for various biological targets. Its molecular structure indicates that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, due to the presence of electron-withdrawing and electron-donating groups. The compound's unique characteristics make it a subject of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation through experimental studies.

Formula: C₁₇H₁₈ClNO₂S

InChI: InChI=1S/C17H18ClNO2S/c1-13-6-8-16(9-7-13)22(20,21)19-11-14(12-19)10-15-4-2-3-5-17(15)18/h2-9,14H,10-12H2,1H3

InChI key: InChIKey=ABENCKJSMYRXIK-UHFFFAOYSA-N

SMILES: O=S(=O)(C1=CC=C(C=C1)C)N2CC(CC=3C=CC=CC3Cl)C2

3-[(2-Chlorophenyl)methyl]-1-(4-methylbenzenesulfonyl)azetidine

CAS: 1354952-50-3

Versatile small molecule scaffold

• Formula: C₁₇H₁₈ClNO₂S
• Purity: Min. 95%
• Molecular weight: 335.8 g/mol

3-(2-Chlorobenzyl)-1-tosylazetidine

CAS: 1354952-50-3

• Purity: 98%
• Molecular weight: 335.8500061035156