CAS 1354952-57-0

4,5,6,7-Tetrahydro-3-methylbenzo[b]thiophen-2-amine

Description:

4,5,6,7-Tetrahydro-3-methylbenzo[b]thiophen-2-amine is a chemical compound characterized by its unique bicyclic structure, which includes a thiophene ring fused to a benzene ring. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that contribute to its saturated nature. The methyl group at the 3-position of the benzo[b]thiophene structure adds to its complexity and influences its chemical reactivity and physical properties. As an amine, it contains a nitrogen atom that can participate in hydrogen bonding, affecting its solubility and interaction with other molecules. The compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 4,5,6,7-Tetrahydro-3-methylbenzo[b]thiophen-2-amine represents a class of compounds that may have potential applications in various fields, including drug development and materials science.

Formula: C₉H₁₃NS

InChI: InChI=1S/C9H13NS/c1-6-7-4-2-3-5-8(7)11-9(6)10/h2-5,10H2,1H3

InChI key: InChIKey=VKSSAYDRUIZCST-UHFFFAOYSA-N

SMILES: CC=1C2=C(SC1N)CCCC2

Synonyms:

• Benzo[b]thiophen-2-amine, 4,5,6,7-tetrahydro-3-methyl-
• 4,5,6,7-Tetrahydro-3-methylbenzo[b]thiophen-2-amine