CAS 1354952-68-3

Methyl 1-[2-(aminosulfonyl)ethyl]-4-piperidinecarboxylate

Description:

Methyl 1-[2-(aminosulfonyl)ethyl]-4-piperidinecarboxylate, identified by its CAS number 1354952-68-3, is a chemical compound characterized by its piperidine structure, which includes a carboxylate functional group and an aminosulfonyl substituent. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential solubility in polar solvents due to the presence of the sulfonamide group. The piperidine ring contributes to its cyclic structure, which can influence its reactivity and biological activity. Methyl esters like this compound are often used in medicinal chemistry for their potential pharmacological properties, including roles in drug design and synthesis. The presence of the aminosulfonyl group may enhance its interaction with biological targets, making it of interest in pharmaceutical research. Additionally, the compound's stability, reactivity, and potential applications can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial settings.

Formula: C₉H₁₈N₂O₄S

InChI: InChI=1S/C9H18N2O4S/c1-15-9(12)8-2-4-11(5-3-8)6-7-16(10,13)14/h8H,2-7H2,1H3,(H2,10,13,14)

InChI key: InChIKey=AKYOQUSGOPGRHZ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1CCN(CCS(N)(=O)=O)CC1

Synonyms:

• 4-Piperidinecarboxylic acid, 1-[2-(aminosulfonyl)ethyl]-, methyl ester
• Methyl 1-[2-(aminosulfonyl)ethyl]-4-piperidinecarboxylate

Methyl 1-(2-sulfamoylethyl)piperidine-4-carboxylate

CAS: 1354952-68-3

Versatile small molecule scaffold

Formula: C₉H₁₈N₂O₄S

Purity: Min. 95%

Molecular weight: 250.32 g/mol

Ref: 3D-EEC95268