CAS 1354952-91-2

Benzenemethanol, α-(1-aminopropyl)-2-fluoro-, hydrochloride (1:1)

Description:

Benzenemethanol, α-(1-aminopropyl)-2-fluoro-, hydrochloride (1:1), with the CAS number 1354952-91-2, is a chemical compound characterized by its structural features that include a benzene ring, a methanol group, and an amino group with a propyl chain. The presence of a fluorine atom at the second position of the benzene ring contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development due to its structural motifs that can interact with biological targets. Its specific characteristics, including melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Safety data should also be consulted, as with any chemical, to understand its handling and potential hazards.

Formula: C₁₀H₁₄FNO·ClH

InChI: InChI=1S/C10H14FNO.ClH/c1-2-9(12)10(13)7-5-3-4-6-8(7)11;/h3-6,9-10,13H,2,12H2,1H3;1H

InChI key: InChIKey=ICWASBIKHAPQIB-UHFFFAOYSA-N

SMILES: C(C(CC)N)(O)C1=C(F)C=CC=C1.Cl

Synonyms:

• Benzenemethanol, α-(1-aminopropyl)-2-fluoro-, hydrochloride (1:1)

2-Amino-1-(2-fluorophenyl)butan-1-ol hydrochloride

Controlled Product

CAS: 1354952-91-2

Versatile small molecule scaffold

Formula: C₁₀H₁₅ClFNO

Purity: Min. 95%

Molecular weight: 219.68 g/mol

Ref: 3D-EEC95291