CAS 1354953-10-8

N-(2-Amino-1-cyclopropyl-2-thioxoethyl)benzamide

Description:

N-(2-Amino-1-cyclopropyl-2-thioxoethyl)benzamide is a chemical compound characterized by its unique structural features, which include a benzamide moiety and a cyclopropyl group. The presence of the thioxoethyl group suggests that it contains a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. This compound may exhibit properties typical of amides, such as moderate solubility in polar solvents and the ability to participate in hydrogen bonding due to the amide functional group. Additionally, the cyclopropyl ring can influence the compound's conformational flexibility and steric properties, potentially affecting its interactions with biological targets. The amino group may also impart basicity, allowing for protonation under certain conditions. Overall, N-(2-Amino-1-cyclopropyl-2-thioxoethyl)benzamide is of interest in medicinal chemistry, particularly for its potential pharmacological applications, although specific biological activities and mechanisms would require further investigation.

Formula: C₁₂H₁₄N₂OS

InChI: InChI=1S/C12H14N2OS/c13-11(16)10(8-6-7-8)14-12(15)9-4-2-1-3-5-9/h1-5,8,10H,6-7H2,(H2,13,16)(H,14,15)

InChI key: InChIKey=QXZWMAIADKSTTR-UHFFFAOYSA-N

SMILES: C(NC(=O)C1=CC=CC=C1)(C(N)=S)C2CC2

N-[Carbamothioyl(cyclopropyl)methyl]benzamide

CAS: 1354953-10-8

Versatile small molecule scaffold

Formula: C₁₂H₁₄N₂OS

Purity: Min. 95%

Molecular weight: 234.32 g/mol

Ref: 3D-EEC95310