CAS 1354953-51-7

2,2,2-Trifluoroethyl N-[6-(1H-benzimidazol-1-yl)-3-pyridinyl]carbamate

Description:

2,2,2-Trifluoroethyl N-[6-(1H-benzimidazol-1-yl)-3-pyridinyl]carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate moiety linked to a benzimidazole-pyridine hybrid. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents, reflecting its polar functional groups. The presence of trifluoroethyl enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical applications. The benzimidazole and pyridine components suggest potential interactions with biological targets, particularly in medicinal chemistry, where such compounds are often explored for their efficacy against various diseases. Additionally, the compound's stability and reactivity can be influenced by the presence of the trifluoroethyl group, which can affect its behavior in different chemical environments. Overall, this compound represents a class of molecules that may exhibit significant pharmacological properties, warranting further investigation in drug development and related fields.

Formula: C₁₅H₁₁F₃N₄O₂

InChI: InChI=1S/C15H11F3N4O2/c16-15(17,18)8-24-14(23)21-10-5-6-13(19-7-10)22-9-20-11-3-1-2-4-12(11)22/h1-7,9H,8H2,(H,21,23)

InChI key: InChIKey=JBPROFFUOCJUDZ-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C1=CC=C(N2C=3C(N=C2)=CC=CC3)N=C1

Synonyms:

• 2,2,2-Trifluoroethyl N-[6-(1H-benzimidazol-1-yl)-3-pyridinyl]carbamate
• Carbamic acid, N-[6-(1H-benzimidazol-1-yl)-3-pyridinyl]-, 2,2,2-trifluoroethyl ester

2,2,2-Trifluoroethyl N-[6-(1H-1,3-benzodiazol-1-yl)pyridin-3-yl]carbamate

CAS: 1354953-51-7

Versatile small molecule scaffold

Formula: C₁₅H₁₁F₃N₄O₂

Purity: Min. 95%

Molecular weight: 336.27 g/mol

Ref: 3D-EEC95351