CAS 1354953-58-4

3-Oxa-7-azabicyclo[3.3.1]nonane, acetate (1:1)

Description:

3-Oxa-7-azabicyclo[3.3.1]nonane, acetate (1:1) is a bicyclic compound characterized by its unique structural framework, which includes both nitrogen and oxygen heteroatoms within its rings. This compound features a bicyclic system that consists of a seven-membered ring containing an oxygen atom and a nitrogen atom, contributing to its potential biological activity. The acetate moiety indicates the presence of an acetyl group, which can influence the compound's solubility and reactivity. Generally, compounds of this type may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of the bicyclic structure often leads to conformational rigidity, which can affect how the molecule interacts with biological targets. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, 3-Oxa-7-azabicyclo[3.3.1]nonane, acetate (1:1) represents a class of compounds that may have significant implications in drug design and development.

Formula: C₇H₁₃NO·C₂H₄O₂

InChI: InChI=1S/C7H13NO.C2H4O2/c1-6-2-8-3-7(1)5-9-4-6;1-2(3)4/h6-8H,1-5H2;1H3,(H,3,4)

InChI key: InChIKey=NXKOLNVDLHZRQT-UHFFFAOYSA-N

SMILES: C12CC(COC1)CNC2.C(C)(O)=O

Synonyms:

• Acetic acid; 3-oxa-7-azabicyclo[3.3.1]nonane
• 3-Oxa-7-azabicyclo[3.3.1]nonane, acetate (1:1)
• 3-Oxa-7-azabicyclo[3.3.1]nonane; acetic acid

3-Oxa-7-azabicyclo[3.3.1]nonane, acetic acid

Controlled Product

CAS: 1354953-58-4

Versatile small molecule scaffold

Formula: C₉H₁₇NO₃

Purity: Min. 95%

Molecular weight: 187.24 g/mol

Ref: 3D-EEC95358