
CAS 1354953-63-1
:1,4-Oxazepine, 2-(2-chlorophenyl)hexahydro-, hydrochloride (1:1)
Description:
1,4-Oxazepine, 2-(2-chlorophenyl)hexahydro-, hydrochloride (1:1) is a chemical compound characterized by its oxazepine ring structure, which consists of a seven-membered heterocyclic ring containing one nitrogen and one oxygen atom. This compound features a hexahydro configuration, indicating it is fully saturated with hydrogen atoms, contributing to its stability and potential biological activity. The presence of a 2-chlorophenyl group suggests that it may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. The compound's molecular structure may impart unique characteristics, such as specific reactivity or binding affinity, making it of interest in medicinal chemistry. Its CAS number, 1354953-63-1, allows for precise identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature. Overall, this compound may hold significance in research and development within the fields of medicinal chemistry and pharmacology.
Formula:C11H14ClNO·ClH
InChI:InChI=1S/C11H14ClNO.ClH/c12-10-5-2-1-4-9(10)11-8-13-6-3-7-14-11;/h1-2,4-5,11,13H,3,6-8H2;1H
InChI key:InChIKey=NNQHANDFSSYMKE-UHFFFAOYSA-N
SMILES:ClC1=C(C2CNCCCO2)C=CC=C1.Cl
Synonyms:- 1,4-Oxazepine, 2-(2-chlorophenyl)hexahydro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.