CAS 1354953-66-4

3-Piperidinecarboxamide, N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1)

Description:

3-Piperidinecarboxamide, N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of the trifluoroethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound may exhibit properties such as being a potential inhibitor or modulator in various biological pathways, although specific biological activities would depend on its interaction with target proteins or receptors. Its molecular structure suggests potential applications in drug development, particularly in areas requiring compounds with enhanced metabolic stability or specific pharmacokinetic profiles. Safety and handling considerations are essential, as with any chemical, particularly those with halogenated groups, which may pose environmental or health risks.

Formula: C₈H₁₃F₃N₂O·ClH

InChI: InChI=1S/C8H13F3N2O.ClH/c9-8(10,11)5-13-7(14)6-2-1-3-12-4-6;/h6,12H,1-5H2,(H,13,14);1H

InChI key: InChIKey=DCJDWPBSAGEAHZ-UHFFFAOYSA-N

SMILES: C(NCC(F)(F)F)(=O)C1CCCNC1.Cl

Synonyms:

• 3-Piperidinecarboxamide, N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1)

N-(2,2,2-Trifluoroethyl)piperidine-3-carboxamide hydrochloride

CAS: 1354953-66-4

Versatile small molecule scaffold

Formula: C₈H₁₄ClF₃N₂O

Purity: Min. 95%

Molecular weight: 246.66 g/mol

Ref: 3D-EEC95366