CAS 1354953-68-6

Methyl 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylate

Description:

Methyl 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylate is a chemical compound characterized by its bicyclic structure, which includes a pyridine ring fused to a cyclopentane moiety. This compound features an amino group and a carboxylate ester, contributing to its potential reactivity and biological activity. The presence of the methyl ester group enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The compound's structural features suggest it may interact with biological targets, potentially exhibiting pharmacological properties. Its CAS number, 1354953-68-6, allows for precise identification and retrieval of information in chemical databases. As with many nitrogen-containing heterocycles, it may participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in different environments. Overall, Methyl 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylate represents a unique scaffold for further exploration in drug development and chemical research.

Formula: C₁₀H₁₂N₂O₂

InChI: InChI=1S/C10H12N2O2/c1-14-10(13)7-5-6-3-2-4-8(6)12-9(7)11/h5H,2-4H2,1H3,(H2,11,12)

InChI key: InChIKey=CGVQVMVKJLUKRP-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C2C(=NC1N)CCC2

Synonyms:

• 5H-Cyclopenta[b]pyridine-3-carboxylic acid, 2-amino-6,7-dihydro-, methyl ester
• Methyl 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxylate

Methyl 2-amino-5H,6H,7H-cyclopenta[b]pyridine-3-carboxylate

CAS: 1354953-68-6

Versatile small molecule scaffold

Formula: C₁₀H₁₂N₂O₂

Purity: Min. 95%

Molecular weight: 192.21 g/mol

Ref: 3D-EEC95368