
CAS 1354953-72-2
:1,1-Dimethylethyl 1-amino-3-ethoxy-7-azaspiro[3.5]nonane-7-carboxylate
Description:
1,1-Dimethylethyl 1-amino-3-ethoxy-7-azaspiro[3.5]nonane-7-carboxylate, identified by its CAS number 1354953-72-2, is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom in a bicyclic framework. This compound features a dimethyl group that enhances its steric properties, potentially influencing its reactivity and interactions with biological systems. The presence of an amino group suggests potential for hydrogen bonding and reactivity in various chemical environments, while the ethoxy group may contribute to its solubility in organic solvents. The carboxylate functional group indicates that it can participate in acid-base reactions, making it a candidate for various applications in medicinal chemistry and drug design. Overall, the structural features of this compound suggest it may exhibit interesting pharmacological properties, although specific biological activity would require further investigation through experimental studies.
Formula:C15H28N2O3
InChI:InChI=1S/C15H28N2O3/c1-5-19-12-10-11(16)15(12)6-8-17(9-7-15)13(18)20-14(2,3)4/h11-12H,5-10,16H2,1-4H3
InChI key:InChIKey=PFTNAMMYIVNWTD-UHFFFAOYSA-N
SMILES:O(CC)C1C2(C(N)C1)CCN(C(OC(C)(C)C)=O)CC2
Synonyms:- 7-Azaspiro[3.5]nonane-7-carboxylic acid, 1-amino-3-ethoxy-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 1-amino-3-ethoxy-7-azaspiro[3.5]nonane-7-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.