CAS 1354953-79-9

2-[(4-Fluorophenyl)sulfonyl]ethanesulfonamide

Description:

2-[(4-Fluorophenyl)sulfonyl]ethanesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a fluorophenyl group enhances its potential biological activity and may influence its pharmacokinetic properties. This compound features a sulfonyl group attached to an ethane backbone, contributing to its solubility and reactivity. It is typically a solid at room temperature and may exhibit moderate stability under standard conditions. The fluorine atom in the para position of the phenyl ring can affect the electronic properties of the molecule, potentially enhancing its interaction with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific diseases. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Safety data should be consulted for handling and usage, as sulfonamides can have specific toxicity profiles.

Formula: C₈H₁₀FNO₄S₂

InChI: InChI=1S/C8H10FNO4S2/c9-7-1-3-8(4-2-7)15(11,12)5-6-16(10,13)14/h1-4H,5-6H2,(H2,10,13,14)

InChI key: InChIKey=KALIPARJWCQDTN-UHFFFAOYSA-N

SMILES: S(CCS(N)(=O)=O)(=O)(=O)C1=CC=C(F)C=C1

Synonyms:

• 2-[(4-Fluorophenyl)sulfonyl]ethanesulfonamide
• Ethanesulfonamide, 2-[(4-fluorophenyl)sulfonyl]-

2-(4-Fluorobenzenesulfonyl)ethane-1-sulfonamide

CAS: 1354953-79-9

Versatile small molecule scaffold

Formula: C₈H₁₀FNO₄S₂

Purity: Min. 95%

Molecular weight: 267.3 g/mol

Ref: 3D-EEC95379