
CAS 1354953-83-5
:3-Azabicyclo[3.1.0]hexan-1-ol
Description:
3-Azabicyclo[3.1.0]hexan-1-ol is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a six-membered ring containing one nitrogen atom and a hydroxyl group (-OH) attached to the first carbon. This compound features a nitrogen atom that contributes to its basicity and potential for forming hydrogen bonds, which can influence its solubility and reactivity. The bicyclic framework imparts rigidity to the molecule, affecting its conformational properties and interactions with other substances. As a secondary amine, it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. The presence of the hydroxyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it can enhance the compound's polarity and biological activity. Overall, 3-Azabicyclo[3.1.0]hexan-1-ol is of interest in both synthetic and medicinal chemistry due to its structural features and functional groups.
Formula:C5H9NO
InChI:InChI=1S/C5H9NO/c7-5-1-4(5)2-6-3-5/h4,6-7H,1-3H2
InChI key:InChIKey=KREAKZAXWQHUJK-UHFFFAOYSA-N
SMILES:OC12C(C1)CNC2
Synonyms:- 1-Hydroxy-3-azabicyclo[3.1.0]hexane
- 3-Azabicyclo[3.1.0]hexan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.