CAS 1354953-85-7

Pyridine, 2-(4-piperidinylmethoxy)-, hydrochloride (1:2)

Description:

Pyridine, 2-(4-piperidinylmethoxy)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its basicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the piperidinyl group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as being a weak base, and it can participate in hydrogen bonding due to the nitrogen atoms in its structure. Its molecular structure allows for various functional group interactions, which can influence its reactivity and stability. Additionally, the hydrochloride form can affect the compound's pharmacokinetics, including absorption and distribution in biological systems. Overall, this compound's unique structural features and solubility profile make it a candidate for further research in drug development and other chemical applications.

Formula: C₁₁H₁₆N₂O·2ClH

InChI: InChI=1S/C11H16N2O.2ClH/c1-2-6-13-11(3-1)14-9-10-4-7-12-8-5-10;;/h1-3,6,10,12H,4-5,7-9H2;2*1H

InChI key: InChIKey=JJWGCSFOPSRYNU-UHFFFAOYSA-N

SMILES: C(OC1=CC=CC=N1)C2CCNCC2.Cl

Synonyms:

• Pyridine, 2-(4-piperidinylmethoxy)-, hydrochloride (1:2)

2-[(piperidin-4-yl)methoxy]pyridine dihydrochloride

CAS: 1354953-85-7

Formula: C₁₁H₁₈Cl₂N₂O

Purity: 95.0%

Molecular weight: 265.18

Ref: 10-F521147

2-(piperidin-4-ylmethoxy)pyridine dihydrochloride

CAS: 1354953-85-7

Versatile small molecule scaffold

Formula: C₁₁H₁₆N₂O·2HCl

Purity: Min. 95%

Molecular weight: 265.17 g/mol

Ref: 3D-EEC95385