CAS 1354953-92-6

4-Piperidineacetic acid, 4-hydroxy-1-methyl-, hydrochloride (1:1)

Description:

4-Piperidineacetic acid, 4-hydroxy-1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group and a hydroxyl group, contributing to its potential as a bioactive molecule. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. Typically, such compounds may exhibit properties relevant to medicinal chemistry, including potential applications in pharmaceuticals due to their ability to interact with biological targets. The presence of both the piperidine and carboxylic acid moieties suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions in biological systems. As with many piperidine derivatives, it may also exhibit central nervous system activity, making it of interest in neuropharmacology. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₈H₁₅NO₃·ClH

InChI: InChI=1S/C8H15NO3.ClH/c1-9-4-2-8(12,3-5-9)6-7(10)11;/h12H,2-6H2,1H3,(H,10,11);1H

InChI key: InChIKey=HWSAIGGMTQOPFV-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1(O)CCN(C)CC1.Cl

Synonyms:

• 4-Piperidineacetic acid, 4-hydroxy-1-methyl-, hydrochloride (1:1)

2-(4-Hydroxy-1-methylpiperidin-4-yl)acetic acid hydrochloride

CAS: 1354953-92-6

Versatile small molecule scaffold

Formula: C₈H₁₆ClNO₃

Purity: Min. 95%

Molecular weight: 209.67 g/mol

Ref: 3D-EEC95392