CAS 1354954-03-2

Benzenemethanol, α-(aminomethyl)-2-chloro-6-fluoro-, hydrochloride (1:1)

Description:

Benzenemethanol, α-(aminomethyl)-2-chloro-6-fluoro-, hydrochloride (1:1), commonly referred to by its CAS number 1354954-03-2, is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with a hydroxymethyl group, an amino group, and halogen substituents (specifically chlorine and fluorine). This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. The presence of the amino group suggests potential basicity, while the halogen atoms can impart unique reactivity and stability characteristics. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and effects would depend on its interaction with biological systems, which could be influenced by the functional groups present. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₈H₉ClFNO.ClH

InChI: InChI=1S/C8H9ClFNO.ClH/c9-5-2-1-3-6(10)8(5)7(12)4-11;/h1-3,7,12H,4,11H2;1H

InChI key: InChIKey=UJQUBXDIRGQTND-UHFFFAOYSA-N

SMILES: C(CN)(O)C1=C(Cl)C=CC=C1F.Cl

2-Amino-1-(2-chloro-6-fluorophenyl)ethan-1-ol hydrochloride

CAS: 1354954-03-2

Versatile small molecule scaffold

Formula: C₈H₁₀Cl₂FNO

Purity: Min. 95%

Molecular weight: 226.07 g/mol

Ref: 3D-EEC95403