CAS 1354954-10-1

Methyl 1-thieno[3,2-c]pyridin-4-yl-4-piperidinecarboxylate

Description:

Methyl 1-thieno[3,2-c]pyridin-4-yl-4-piperidinecarboxylate is a chemical compound characterized by its complex structure, which includes a thieno[3,2-c]pyridine ring fused with a piperidine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to its unique arrangement of nitrogen and sulfur atoms within the ring systems. The presence of the methyl ester functional group suggests it may participate in esterification reactions and could be hydrolyzed to yield the corresponding carboxylic acid. Its molecular structure may confer lipophilicity, influencing its solubility in organic solvents and biological membranes. Additionally, compounds of this nature are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. The specific interactions and reactivity of Methyl 1-thieno[3,2-c]pyridin-4-yl-4-piperidinecarboxylate would depend on its stereochemistry and the presence of substituents, which can significantly affect its biological activity and chemical behavior.

Formula: C₁₄H₁₆N₂O₂S

InChI: InChI=1S/C14H16N2O2S/c1-18-14(17)10-3-7-16(8-4-10)13-11-5-9-19-12(11)2-6-15-13/h2,5-6,9-10H,3-4,7-8H2,1H3

InChI key: InChIKey=MVMCJRBPPJABQO-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1CCN(C2=C3C(SC=C3)=CC=N2)CC1

Synonyms:

• 4-Piperidinecarboxylic acid, 1-thieno[3,2-c]pyridin-4-yl-, methyl ester
• Methyl 1-thieno[3,2-c]pyridin-4-yl-4-piperidinecarboxylate

Methyl 1-{thieno[3,2-c]pyridin-4-yl}piperidine-4-carboxylate

CAS: 1354954-10-1

Versatile small molecule scaffold

Formula: C₁₄H₁₆N₂O₂S

Purity: Min. 95%

Molecular weight: 276.36 g/mol

Ref: 3D-EEC95410