CAS 1354954-14-5

Cyclopropanamine, 2-(2-methoxyphenyl)-2-methyl-, hydrochloride (1:1)

Description:

Cyclopropanamine, 2-(2-methoxyphenyl)-2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its cyclopropane structure, which contributes to its unique reactivity and steric properties. The presence of a 2-methoxyphenyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The compound's molecular structure suggests potential interactions with biological targets, which may be explored for therapeutic purposes. Additionally, the hydrochloride form can stabilize the amine group, affecting its protonation state and reactivity in different environments. Overall, this compound's characteristics, including its molecular framework and solubility profile, make it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₁₁H₁₅NO·ClH

InChI: InChI=1S/C11H15NO.ClH/c1-11(7-10(11)12)8-5-3-4-6-9(8)13-2;/h3-6,10H,7,12H2,1-2H3;1H

InChI key: InChIKey=KNKZJWPSCFLPQX-UHFFFAOYSA-N

SMILES: CC1(C(N)C1)C2=C(OC)C=CC=C2.Cl

Synonyms:

• Cyclopropanamine, 2-(2-methoxyphenyl)-2-methyl-, hydrochloride (1:1)

2-(2-Methoxyphenyl)-2-methylcyclopropan-1-amine hydrochloride

CAS: 1354954-14-5

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClNO

Purity: Min. 95%

Molecular weight: 213.7 g/mol

Ref: 3D-EEC95414