CymitQuimica logo

CAS 1354954-56-5

:

4(3H)-Pyrimidinone, 2-(1-amino-1-methylpropyl)-5,6-dimethyl-, hydrochloride (1:1)

Description:
4(3H)-Pyrimidinone, 2-(1-amino-1-methylpropyl)-5,6-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidinone core structure, which features a six-membered aromatic ring containing nitrogen atoms. This compound exhibits basic properties due to the presence of an amino group, which can participate in hydrogen bonding and influence its solubility in polar solvents. The dimethyl substitutions at the 5 and 6 positions of the pyrimidinone ring contribute to its steric and electronic properties, potentially affecting its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the presence of the hydrochloride moiety, which can also affect its formulation and delivery in therapeutic contexts. Overall, this compound represents a unique structure with potential applications in drug development and research.
Formula:C10H17N3O·ClH
InChI:InChI=1S/C10H17N3O.ClH/c1-5-10(4,11)9-12-7(3)6(2)8(14)13-9;/h5,11H2,1-4H3,(H,12,13,14);1H
InChI key:InChIKey=XNOWSGLJFCRDIB-UHFFFAOYSA-N
SMILES:C(CC)(C)(N)C=1NC(C)=C(C)C(=O)N1.Cl
Synonyms:
  • 4(3H)-Pyrimidinone, 2-(1-amino-1-methylpropyl)-5,6-dimethyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.