CAS 1354957-82-6

3-Pyrrolidineacetic acid, 1-(phenylmethyl)-, hydrochloride (1:1)

Description:

3-Pyrrolidineacetic acid, 1-(phenylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine and acetic acid functional groups, along with a phenylmethyl substituent. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The molecular structure suggests it may exhibit properties such as being a potential neurotransmitter modulator or having applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system. Its hydrochloride form indicates that it is a salt, which can influence its stability and bioavailability. Safety data sheets would typically recommend handling it with care, as with many organic compounds, due to potential irritant properties. As with any chemical, proper storage and handling protocols should be followed to ensure safety and maintain compound integrity.

Formula: C₁₃H₁₇NO₂·ClH

InChI: InChI=1S/C13H17NO2.ClH/c15-13(16)8-12-6-7-14(10-12)9-11-4-2-1-3-5-11;/h1-5,12H,6-10H2,(H,15,16);1H

InChI key: InChIKey=WRJMRACGAMJSSM-UHFFFAOYSA-N

SMILES: C(N1CC(CC(O)=O)CC1)C2=CC=CC=C2.Cl

Synonyms:

• 3-Pyrrolidineacetic acid, 1-(phenylmethyl)-, hydrochloride (1:1)

2-(1-Benzylpyrrolidin-3-yl)acetic acid hydrochloride

CAS: 1354957-82-6

Versatile small molecule scaffold

Formula: C₁₃H₁₈ClNO₂

Purity: Min. 95%

Molecular weight: 255.74 g/mol

Ref: 3D-EEC95782