CymitQuimica logo

CAS 1354958-24-9

:

3-(2-Methoxy-5-nitrophenyl)-2-oxazolidinone

Description:
3-(2-Methoxy-5-nitrophenyl)-2-oxazolidinone is a chemical compound characterized by its oxazolidinone core, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a methoxy group and a nitrophenyl substituent, contributing to its unique chemical properties. The presence of the nitro group typically enhances the compound's reactivity and can influence its electronic properties, making it potentially useful in various chemical reactions or applications. The methoxy group can affect solubility and polarity, which are important for its behavior in different solvents or biological systems. Additionally, oxazolidinones are known for their applications in medicinal chemistry, particularly as scaffolds in drug development. The specific arrangement of substituents in this compound may also impart biological activity, making it a candidate for further research in pharmacology. Overall, 3-(2-Methoxy-5-nitrophenyl)-2-oxazolidinone exemplifies the complexity and versatility of organic compounds in both synthetic and applied chemistry contexts.
Formula:C10H10N2O5
InChI:InChI=1S/C10H10N2O5/c1-16-9-3-2-7(12(14)15)6-8(9)11-4-5-17-10(11)13/h2-3,6H,4-5H2,1H3
InChI key:InChIKey=ZJWARTJOUADBIR-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(N(=O)=O)C=C1)N2C(=O)OCC2
Synonyms:
  • 2-Oxazolidinone, 3-(2-methoxy-5-nitrophenyl)-
  • 3-(2-Methoxy-5-nitrophenyl)-2-oxazolidinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.