CAS 1354961-14-0

3-Piperidinecarboxamide, N-ethyl-N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1)

Description:

3-Piperidinecarboxamide, N-ethyl-N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential as a pharmacological agent. The presence of the N-ethyl and 2,2,2-trifluoroethyl substituents enhances its lipophilicity and may influence its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including medicinal chemistry. The trifluoroethyl group is notable for imparting unique electronic properties, which can affect the compound's reactivity and binding affinity. This compound may exhibit biological activity, making it of interest in drug development, particularly in the context of central nervous system disorders or other therapeutic areas. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₀H₁₇F₃N₂O·ClH

InChI: InChI=1S/C10H17F3N2O.ClH/c1-2-15(7-10(11,12)13)9(16)8-4-3-5-14-6-8;/h8,14H,2-7H2,1H3;1H

InChI key: InChIKey=MFGUGKVVPWASQN-UHFFFAOYSA-N

SMILES: N(C(=O)C1CCCNC1)(CC(F)(F)F)CC.Cl

Synonyms:

• 3-Piperidinecarboxamide, N-ethyl-N-(2,2,2-trifluoroethyl)-, hydrochloride (1:1)

N-Ethyl-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide hydrochloride

CAS: 1354961-14-0

Versatile small molecule scaffold

Formula: C₁₀H₁₈ClF₃N₂O

Purity: Min. 95%

Molecular weight: 274.71 g/mol

Ref: 3D-EEC96114