CAS 1354962-56-3
:2-Methyl-1-phenyl-1H-imidazole-5-methanol
Description:
2-Methyl-1-phenyl-1H-imidazole-5-methanol is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a methyl group and a phenyl group, contributing to its unique properties and potential applications. The presence of the hydroxymethyl group at the 5-position of the imidazole ring enhances its solubility in polar solvents and may influence its reactivity and biological activity. Generally, compounds of this type can exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, melting point, and solubility characteristics would be essential for practical applications, including drug formulation and synthesis. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding toxicity and environmental impact.
Formula:C11H12N2O
InChI:InChI=1S/C11H12N2O/c1-9-12-7-11(8-14)13(9)10-5-3-2-4-6-10/h2-7,14H,8H2,1H3
InChI key:InChIKey=LCFSTJUTFGHJNA-UHFFFAOYSA-N
SMILES:C(O)C=1N(C(C)=NC1)C2=CC=CC=C2
Synonyms:- 1H-Imidazole-5-methanol, 2-methyl-1-phenyl-
- 2-Methyl-1-phenyl-1H-imidazole-5-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.