CAS 1354963-16-8

3H-Imidazo[4,5-b]pyridine-2-methanamine, 6-bromo-, hydrochloride (1:2)

Description:

3H-Imidazo[4,5-b]pyridine-2-methanamine, 6-bromo-, hydrochloride (1:2) is a chemical compound characterized by its imidazo-pyridine structure, which features a fused ring system that includes both imidazole and pyridine moieties. The presence of a bromine atom at the 6-position of the pyridine ring contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, particularly in pharmaceutical contexts. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, which can be explored in drug development. The compound's CAS number, 1354963-16-8, serves as a unique identifier for regulatory and research purposes. Overall, the characteristics of this substance suggest it may play a significant role in the development of new therapeutic agents.

Formula: C₇H₇BrN₄·2ClH

InChI: InChI=1S/C7H7BrN4.2ClH/c8-4-1-5-7(10-3-4)12-6(2-9)11-5;;/h1,3H,2,9H2,(H,10,11,12);2*1H

InChI key: InChIKey=HPPMYOHAMOAWAH-UHFFFAOYSA-N

SMILES: C(N)C1=NC=2C(N1)=CC(Br)=CN2.Cl

Synonyms:

• 3H-Imidazo[4,5-b]pyridine-2-methanamine, 6-bromo-, hydrochloride (1:2)
• [6-Bromo-1H-imidazo[4,5-b]pyridin-2-yl]methanamine dihydrochloride

{6-Bromo-1H-imidazo[4,5-b]pyridin-2-yl}methanamine dihydrochloride

CAS: 1354963-16-8

Versatile small molecule scaffold

Formula: C₇H₉BrCl₂N₄

Purity: Min. 95%

Molecular weight: 299.98 g/mol

Ref: 3D-EEC96316