CAS 1354963-18-0

2-Propanamine, N-[2-[(6-bromo-2-naphthalenyl)oxy]ethyl]-, hydrochloride (1:1)

Description:

2-Propanamine, N-[2-[(6-bromo-2-naphthalenyl)oxy]ethyl]-, hydrochloride (1:1), with CAS number 1354963-18-0, is a chemical compound characterized by its amine functional group and a naphthalene derivative. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the bromo substituent on the naphthalene ring may impart specific reactivity and biological activity, making it of interest in medicinal chemistry and pharmacology. The compound's structure suggests potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. Additionally, the amine group may participate in hydrogen bonding, influencing its interactions with other molecules. As with many amines, it may exhibit basic properties, and safety precautions should be taken when handling it, as it could be irritant or toxic depending on exposure levels.

Formula: C₁₅H₁₈BrNO·ClH

InChI: InChI=1S/C15H18BrNO.ClH/c1-11(2)17-7-8-18-15-6-4-12-9-14(16)5-3-13(12)10-15;/h3-6,9-11,17H,7-8H2,1-2H3;1H

InChI key: InChIKey=KSYJWMXIMCLCJB-UHFFFAOYSA-N

SMILES: O(CCNC(C)C)C1=CC2=C(C=C1)C=C(Br)C=C2.Cl

Synonyms:

• 2-Propanamine, N-[2-[(6-bromo-2-naphthalenyl)oxy]ethyl]-, hydrochloride (1:1)

{2-[(6-Bromonaphthalen-2-yl)oxy]ethyl}(propan-2-yl)amine hydrochloride

CAS: 1354963-18-0

Versatile small molecule scaffold

Formula: C₁₅H₁₉BrClNO

Purity: Min. 95%

Molecular weight: 344.67 g/mol

Ref: 3D-EEC96318