CAS 1354963-20-4

Ethyl 2-amino-3,5-difluoro-4-methoxybenzoate

Description:

Ethyl 2-amino-3,5-difluoro-4-methoxybenzoate is a chemical compound characterized by its unique functional groups and structural features. It belongs to the class of benzoate esters, which are derived from benzoic acid. The presence of an ethyl group indicates that it is an ester, while the amino group suggests potential basicity and reactivity in various chemical reactions. The difluoro substituents at the 3 and 5 positions of the aromatic ring contribute to its electronic properties, potentially enhancing its reactivity and influencing its interactions with biological systems. The methoxy group at the 4 position can also affect solubility and polarity, making the compound of interest in medicinal chemistry and material science. Overall, this compound's unique combination of functional groups may impart specific biological activities or chemical reactivity, making it a candidate for further research in pharmaceuticals or agrochemicals. Its CAS number, 1354963-20-4, allows for precise identification in chemical databases and literature.

Formula: C₁₀H₁₁F₂NO₃

InChI: InChI=1S/C10H11F2NO3/c1-3-16-10(14)5-4-6(11)9(15-2)7(12)8(5)13/h4H,3,13H2,1-2H3

InChI key: InChIKey=YYSRVWSLQXFJCB-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(N)C(F)=C(OC)C(F)=C1

Synonyms:

• Ethyl 2-amino-3,5-difluoro-4-methoxybenzoate
• Benzoic acid, 2-amino-3,5-difluoro-4-methoxy-, ethyl ester