CAS 1354963-37-3

1H-Benzimidazol-2-amine, 1-(4-methylphenyl)-, hydrochloride (1:1)

Description:

1H-Benzimidazol-2-amine, 1-(4-methylphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features an amine group at the 2-position of the benzimidazole and a para-methylphenyl substituent at the 1-position, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the amine group suggests potential basicity, while the aromatic rings may impart stability and influence its interaction with biological targets. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its CAS number, 1354963-37-3, allows for precise identification and retrieval of information related to its synthesis, properties, and potential applications in research and industry.

Formula: C₁₄H₁₃N₃·ClH

InChI: InChI=1S/C14H13N3.ClH/c1-10-6-8-11(9-7-10)17-13-5-3-2-4-12(13)16-14(17)15;/h2-9H,1H3,(H2,15,16);1H

InChI key: InChIKey=UECWOEWHUYZJDP-UHFFFAOYSA-N

SMILES: NC=1N(C=2C(N1)=CC=CC2)C3=CC=C(C)C=C3.Cl

Synonyms:

• 1H-Benzimidazol-2-amine, 1-(4-methylphenyl)-, hydrochloride (1:1)

1-(4-Methylphenyl)-1H-1,3-benzodiazol-2-amine hydrochloride

CAS: 1354963-37-3

Versatile small molecule scaffold

Formula: C₁₄H₁₄ClN₃

Purity: Min. 95%

Molecular weight: 259.73 g/mol

Ref: 3D-EEC96337