CymitQuimica logo

CAS 1354963-56-6

:

4-(2,2,2-Trifluoroethyl)-2-azetidinone

Description:
4-(2,2,2-Trifluoroethyl)-2-azetidinone is a chemical compound characterized by its azetidinone structure, which features a four-membered ring containing a nitrogen atom and a carbonyl group. The presence of the trifluoroethyl group significantly influences its chemical properties, imparting high electronegativity and lipophilicity due to the three fluorine atoms. This substitution can enhance the compound's stability and reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The compound's molecular structure suggests potential for hydrogen bonding and dipole interactions, which can affect its solubility and reactivity in different solvents. Additionally, the azetidinone moiety may exhibit biological activity, making it a candidate for further research in medicinal chemistry. Overall, 4-(2,2,2-Trifluoroethyl)-2-azetidinone is notable for its unique structural features and potential applications in synthetic chemistry and drug development.
Formula:C5H6F3NO
InChI:InChI=1S/C5H6F3NO/c6-5(7,8)2-3-1-4(10)9-3/h3H,1-2H2,(H,9,10)
InChI key:InChIKey=UOLROHFRRRKKNV-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)C1CC(=O)N1
Synonyms:
  • 4-(2,2,2-Trifluoroethyl)-2-azetidinone
  • 2-Azetidinone, 4-(2,2,2-trifluoroethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.