
CAS 1354963-77-1
:2-Isothiazolidineethanamine, N-methyl-, 1,1-dioxide, hydrochloride (1:1)
Description:
2-Isothiazolidineethanamine, N-methyl-, 1,1-dioxide, hydrochloride (1:1) is a chemical compound characterized by its isothiazolidine ring structure, which incorporates a nitrogen and sulfur atom within a five-membered ring. This compound features a methyl group attached to the nitrogen atom, contributing to its amine properties. The presence of the 1,1-dioxide indicates that there are two oxygen atoms double-bonded to the sulfur atom, enhancing its reactivity and solubility in polar solvents. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications in pharmaceuticals and biochemistry. The compound may exhibit biological activity, potentially influencing neurotransmitter systems or other physiological processes, although specific pharmacological effects would depend on further research. Its molecular structure suggests it could participate in nucleophilic reactions due to the presence of the amine group, while the isothiazolidine framework may confer unique properties relevant to medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.
Formula:C6H14N2O2S·ClH
InChI:InChI=1S/C6H14N2O2S.ClH/c1-7-3-5-8-4-2-6-11(8,9)10;/h7H,2-6H2,1H3;1H
InChI key:InChIKey=UHZMMTUDQPUGJO-UHFFFAOYSA-N
SMILES:C(CNC)N1S(=O)(=O)CCC1.Cl
Synonyms:- 2-Isothiazolidineethanamine, N-methyl-, 1,1-dioxide, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.