CAS 1354963-81-7

Benzenepropanol, β-(aminomethyl)-3-hydroxy-4-methoxy-, hydrochloride (1:1)

Description:

Benzenepropanol, β-(aminomethyl)-3-hydroxy-4-methoxy-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzene ring, a propanol moiety, and functional groups such as an amino group and hydroxyl group. The presence of the methoxy group enhances its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. This compound may exhibit biological activity due to its structural features, potentially interacting with various biological targets. It is important to note that compounds with similar structures can have diverse pharmacological effects, and the specific properties, such as melting point, boiling point, and solubility, can vary based on the purity and specific formulation. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Further research may be necessary to fully understand its applications and effects in various fields, including medicinal chemistry and pharmacology.

Formula: C₁₁H₁₇NO₃·ClH

InChI: InChI=1S/C11H17NO3.ClH/c1-15-11-3-2-8(5-10(11)14)4-9(6-12)7-13;/h2-3,5,9,13-14H,4,6-7,12H2,1H3;1H

InChI key: InChIKey=KICZTEGWXFTGGJ-UHFFFAOYSA-N

SMILES: C(C(CN)CO)C1=CC(O)=C(OC)C=C1.Cl

Synonyms:

• Benzenepropanol, β-(aminomethyl)-3-hydroxy-4-methoxy-, hydrochloride (1:1)

5-[2-(Aminomethyl)-3-hydroxypropyl]-2-methoxyphenol hydrochloride

CAS: 1354963-81-7

Versatile small molecule scaffold

Formula: C₁₁H₁₈ClNO₃

Purity: Min. 95%

Molecular weight: 247.72 g/mol

Ref: 3D-EEC96381