CAS 135497-86-8
:flurbiprofen N-(3-(3-(1-piperidinylmethyl)phenoxy)propyl)-2-(2-hydroxyethylthio)acetamide
Description:
Flurbiprofen N-(3-(3-(1-piperidinylmethyl)phenoxy)propyl)-2-(2-hydroxyethylthio)acetamide is a synthetic compound that belongs to the class of nonsteroidal anti-inflammatory drugs (NSAIDs). It is characterized by its complex molecular structure, which includes a flurbiprofen moiety, a piperidine ring, and a hydroxyethylthio group. This compound exhibits anti-inflammatory and analgesic properties, making it useful in the treatment of pain and inflammation. Its mechanism of action typically involves the inhibition of cyclooxygenase enzymes, leading to a reduction in the synthesis of prostaglandins, which are mediators of inflammation and pain. The presence of the piperidinylmethyl group may enhance its pharmacokinetic properties, potentially improving its bioavailability and therapeutic efficacy. Additionally, the compound's solubility, stability, and interaction with biological systems are influenced by its functional groups. As with many NSAIDs, potential side effects may include gastrointestinal disturbances, cardiovascular risks, and renal effects, necessitating careful consideration in clinical use.
Formula:C34H41FN2O4S
InChI:InChI=1/C34H41FN2O4S/c1-26(29-14-15-31(32(35)23-29)28-11-4-2-5-12-28)34(39)41-20-21-42-25-33(38)36-16-9-19-40-30-13-8-10-27(22-30)24-37-17-6-3-7-18-37/h2,4-5,8,10-15,22-23,26H,3,6-7,9,16-21,24-25H2,1H3,(H,36,38)
SMILES:CC(c1ccc(c2ccccc2)c(c1)F)C(=O)OCCSCC(=NCCCOc1cccc(c1)CN1CCCCC1)O
Synonyms:- (2-Hydroxyethylthio)Acetamide
- 2-{[2-Oxo-2-({3-[3-(Piperidin-1-Ylmethyl)Phenoxy]Propyl}Amino)Ethyl]Sulfanyl}Ethyl 2-(2-Fluorobiphenyl-4-Yl)Propanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.