CymitQuimica logo

CAS 1355004-59-9

:

4-Cyclohexylproline methyl ester

Description:
4-Cyclohexylproline methyl ester is an organic compound characterized by its proline derivative structure, which includes a cyclohexyl group and a methyl ester functional group. This compound typically exhibits properties associated with amino acids, such as the ability to participate in hydrogen bonding due to the presence of the amine and carboxylate functionalities. The cyclohexyl group contributes to its hydrophobic characteristics, influencing its solubility in various solvents. As a methyl ester, it is likely to be more lipophilic compared to its corresponding acid form, which can affect its biological activity and interactions. The compound may be of interest in medicinal chemistry and drug design, particularly in the development of compounds that target specific biological pathways or receptors. Additionally, its structural features may allow for conformational flexibility, which is important in the context of molecular recognition and binding affinity. Overall, 4-Cyclohexylproline methyl ester represents a unique scaffold for further exploration in synthetic and medicinal chemistry.
Formula:C12H21NO2
InChI:InChI=1S/C12H21NO2/c1-15-12(14)11-7-10(8-13-11)9-5-3-2-4-6-9/h9-11,13H,2-8H2,1H3
InChI key:InChIKey=DWPWUTVKBYXVLI-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1CC(CN1)C2CCCCC2
Synonyms:
  • Proline, 4-cyclohexyl-, methyl ester
  • 4-Cyclohexylproline methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.