
CAS 1355066-36-2
:3-Chloro-2-[(3,3-difluorocyclobutyl)methoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:
3-Chloro-2-[(3,3-difluorocyclobutyl)methoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a complex organic compound characterized by its unique structural features, including a pyridine ring, a chloro substituent, and a boron-containing moiety. The presence of the difluorocyclobutyl group contributes to its potential lipophilicity and steric properties, which may influence its biological activity and solubility. The dioxaborolane unit is notable for its role in facilitating chemical reactions, particularly in organoboron chemistry, and may enhance the compound's reactivity in cross-coupling reactions. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the electronic effects of the substituents. Overall, this compound represents a valuable structure for further exploration in various chemical applications, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C16H21BClF2NO3
InChI:InChI=1S/C16H21BClF2NO3/c1-14(2)15(3,4)24-17(23-14)11-5-12(18)13(21-8-11)22-9-10-6-16(19,20)7-10/h5,8,10H,6-7,9H2,1-4H3
InChI key:InChIKey=OCOLGWDOZHIBFZ-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(Cl)C(OCC3CC(F)(F)C3)=NC2
Synonyms:- Pyridine, 3-chloro-2-[(3,3-difluorocyclobutyl)methoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 3-Chloro-2-[(3,3-difluorocyclobutyl)methoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.