CymitQuimica logo

CAS 1355066-42-0

:

5-Chloro-6-(2-methylpropoxy)-3-pyridinol

Description:
5-Chloro-6-(2-methylpropoxy)-3-pyridinol is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 5-position and a 2-methylpropoxy group at the 6-position contributes to its unique properties. This compound is likely to exhibit moderate polarity due to the presence of the hydroxyl group (-OH) in the pyridinol structure, which can engage in hydrogen bonding. The 2-methylpropoxy substituent enhances its lipophilicity, potentially influencing its solubility in organic solvents. As a pyridinol derivative, it may possess biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, depending on the reaction conditions. Overall, 5-Chloro-6-(2-methylpropoxy)-3-pyridinol is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C9H12ClNO2
InChI:InChI=1S/C9H12ClNO2/c1-6(2)5-13-9-8(10)3-7(12)4-11-9/h3-4,6,12H,5H2,1-2H3
InChI key:InChIKey=ILOUKZPAZLUKOB-UHFFFAOYSA-N
SMILES:O(CC(C)C)C1=C(Cl)C=C(O)C=N1
Synonyms:
  • 5-Chloro-6-(2-methylpropoxy)-3-pyridinol
  • 3-Pyridinol, 5-chloro-6-(2-methylpropoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.